C21H22N4O5 — CID 8806245
methyl 4-[(E)-3-oxo-3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]prop-1-enyl]benzoate (PubChem CID 8806245) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl 4-[(E)-3-oxo-3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-oxo-3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 8806245 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl 4-[(E)-3-oxo-3-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)OCC(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C21H22N4O5/c1-29-20(28)17-6-3-16(4-7-17)5-8-19(27)30-15-18(26)24-11-13-25(14-12-24)21-22-9-2-10-23-21/h2-10H,11-15H2,1H3/b8-5+ |
| InChIKey | RLNCLLZVBBKRCO-VMPITWQZSA-N |
| XLogP | 1.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|