About [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate (PubChem CID 8806357) has the molecular formula C18H15NO6
and a molecular weight of 341.32 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate.
Molecular Properties
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate |
| PubChem CID | 8806357 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate |
| SMILES | CC(=O)c1ccc(OCC(=O)OCc2cc(-c3ccco3)on2)cc1 |
| InChI | InChI=1S/C18H15NO6/c1-12(20)13-4-6-15(7-5-13)23-11-18(21)24-10-14-9-17(25-19-14)16-3-2-8-22-16/h2-9H,10-11H2,1H3 |
| InChIKey | FGRFTLIJVLVNJM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate?
The IUPAC name of [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate (CID 8806357) is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate.
What is the SMILES notation for [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate?
The canonical SMILES for [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate is CC(=O)c1ccc(OCC(=O)OCc2cc(-c3ccco3)on2)cc1.
What is the InChIKey of [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate?
The InChIKey is FGRFTLIJVLVNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO6/c1-12(20)13-4-6-15(7-5-13)23-11-18(21)24-10-14-9-17(25-19-14)16-3-2-8-22-16/h2-9H,10-11H2,1H3.
What are the key properties of [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate?
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate has a molecular weight of 341.32 g/mol, XLogP of 3.26, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-(4-acetylphenoxy)acetate is sourced from PubChem (CID 8806357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).