About 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine
2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 8806555) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine |
| PubChem CID | 8806555 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCc2ncc(-c3ccccc3)o2)n1 |
| InChI | InChI=1S/C14H13N5OS/c15-11-6-12(16)19-14(18-11)21-8-13-17-7-10(20-13)9-4-2-1-3-5-9/h1-7H,8H2,(H4,15,16,18,19) |
| InChIKey | AJHSTKPCGGIXPH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine?
The IUPAC name of 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine (CID 8806555) is 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine.
What is the SMILES notation for 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine?
The canonical SMILES for 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine is Nc1cc(N)nc(SCc2ncc(-c3ccccc3)o2)n1.
What is the InChIKey of 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine?
The InChIKey is AJHSTKPCGGIXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c15-11-6-12(16)19-14(18-11)21-8-13-17-7-10(20-13)9-4-2-1-3-5-9/h1-7H,8H2,(H4,15,16,18,19).
What are the key properties of 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine?
2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine has a molecular weight of 299.36 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-phenyl-1,3-oxazol-2-yl)methylsulfanyl]pyrimidine-4,6-diamine is sourced from PubChem (CID 8806555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).