C20H25N5O2S — CID 8806998
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 8806998) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 8806998 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1occc1-c1nnc(SCC(=O)N(C)Cc2ccc(N(C)C)cc2)n1C |
| InChI | InChI=1S/C20H25N5O2S/c1-14-17(10-11-27-14)19-21-22-20(25(19)5)28-13-18(26)24(4)12-15-6-8-16(9-7-15)23(2)3/h6-11H,12-13H2,1-5H3 |
| InChIKey | SJIKKYPAXKPKHP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|