About N,2-dicyclohexylacetamide
N,2-dicyclohexylacetamide (PubChem CID 880907) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N,2-dicyclohexylacetamide.
Molecular Properties
| Compound Name | N,2-dicyclohexylacetamide |
| PubChem CID | 880907 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N,2-dicyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H25NO/c16-14(11-12-7-3-1-4-8-12)15-13-9-5-2-6-10-13/h12-13H,1-11H2,(H,15,16) |
| InChIKey | VCFNWIXOBCGNDE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,2-dicyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dicyclohexylacetamide?
The IUPAC name of N,2-dicyclohexylacetamide (CID 880907) is N,2-dicyclohexylacetamide.
What is the SMILES notation for N,2-dicyclohexylacetamide?
The canonical SMILES for N,2-dicyclohexylacetamide is O=C(CC1CCCCC1)NC1CCCCC1.
What is the InChIKey of N,2-dicyclohexylacetamide?
The InChIKey is VCFNWIXOBCGNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c16-14(11-12-7-3-1-4-8-12)15-13-9-5-2-6-10-13/h12-13H,1-11H2,(H,15,16).
What are the key properties of N,2-dicyclohexylacetamide?
N,2-dicyclohexylacetamide has a molecular weight of 223.36 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dicyclohexylacetamide is sourced from PubChem (CID 880907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).