C22H33N3O2 — CID 8810032
N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide (PubChem CID 8810032) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 8810032 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)NCCC1=CCCCC1)CC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H33N3O2/c1-3-15-25(17-22(27)24-20-12-8-7-9-18(20)2)16-21(26)23-14-13-19-10-5-4-6-11-19/h7-10,12H,3-6,11,13-17H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | XEJHISATWISWBY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|