C22H24ClN3O — CID 8810094
2-[(2-chloroquinolin-3-yl)methyl-propylamino]-N-(2-methylphenyl)acetamide (PubChem CID 8810094) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-[(2-chloroquinolin-3-yl)methyl-propylamino]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroquinolin-3-yl)methyl-propylamino]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8810094 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[(2-chloroquinolin-3-yl)methyl-propylamino]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C22H24ClN3O/c1-3-12-26(15-21(27)24-19-10-6-4-8-16(19)2)14-18-13-17-9-5-7-11-20(17)25-22(18)23/h4-11,13H,3,12,14-15H2,1-2H3,(H,24,27) |
| InChIKey | JPFNNIHEZDNFCT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|