C24H33N3O3 — CID 8810719
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 8810719) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 8810719 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)NCc1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C24H33N3O3/c28-22(12-15-27-23(29)20-10-4-5-11-21(20)24(27)30)25-16-18-8-2-3-9-19(18)17-26-13-6-1-7-14-26/h2-3,8-9,20-21H,1,4-7,10-17H2,(H,25,28)/t20-,21-/m0/s1 |
| InChIKey | ZPSPJERANGOAPD-SFTDATJTSA-N |
| XLogP | 2.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|