C12H13N3O2 — CID 8811343
ethyl (E)-2-cyano-3-[(6-methyl-2-pyridinyl)amino]prop-2-enoate (PubChem CID 8811343) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[(6-methyl-2-pyridinyl)amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[(6-methyl-2-pyridinyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 8811343 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | ethyl (E)-2-cyano-3-[(6-methyl-2-pyridinyl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cccc(C)n1 |
| InChI | InChI=1S/C12H13N3O2/c1-3-17-12(16)10(7-13)8-14-11-6-4-5-9(2)15-11/h4-6,8H,3H2,1-2H3,(H,14,15)/b10-8+ |
| InChIKey | CXDUTOFALHBSBZ-CSKARUKUSA-N |
| XLogP | 1.77 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|