About N-(4-anilinophenyl)-3,5-dimethoxybenzamide
N-(4-anilinophenyl)-3,5-dimethoxybenzamide (PubChem CID 881165) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(4-anilinophenyl)-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(4-anilinophenyl)-3,5-dimethoxybenzamide |
| PubChem CID | 881165 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(4-anilinophenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-25-19-12-15(13-20(14-19)26-2)21(24)23-18-10-8-17(9-11-18)22-16-6-4-3-5-7-16/h3-14,22H,1-2H3,(H,23,24) |
| InChIKey | LSUXTPHTNWLXGA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-anilinophenyl)-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-anilinophenyl)-3,5-dimethoxybenzamide?
The IUPAC name of N-(4-anilinophenyl)-3,5-dimethoxybenzamide (CID 881165) is N-(4-anilinophenyl)-3,5-dimethoxybenzamide.
What is the SMILES notation for N-(4-anilinophenyl)-3,5-dimethoxybenzamide?
The canonical SMILES for N-(4-anilinophenyl)-3,5-dimethoxybenzamide is COc1cc(OC)cc(C(=O)Nc2ccc(Nc3ccccc3)cc2)c1.
What is the InChIKey of N-(4-anilinophenyl)-3,5-dimethoxybenzamide?
The InChIKey is LSUXTPHTNWLXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-25-19-12-15(13-20(14-19)26-2)21(24)23-18-10-8-17(9-11-18)22-16-6-4-3-5-7-16/h3-14,22H,1-2H3,(H,23,24).
What are the key properties of N-(4-anilinophenyl)-3,5-dimethoxybenzamide?
N-(4-anilinophenyl)-3,5-dimethoxybenzamide has a molecular weight of 348.40 g/mol, XLogP of 4.70, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-anilinophenyl)-3,5-dimethoxybenzamide is sourced from PubChem (CID 881165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).