C11H10N6O2S — CID 8812028
methyl 3-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 8812028) has the molecular formula C11H10N6O2S and a molecular weight of 290.31 g/mol. Its IUPAC name is methyl 3-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | methyl 3-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 8812028 |
| Molecular Formula | C11H10N6O2S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl 3-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | COC(=O)c1nc(N/C=C(\C#N)c2nc(C)cs2)n[nH]1 |
| InChI | InChI=1S/C11H10N6O2S/c1-6-5-20-9(14-6)7(3-12)4-13-11-15-8(16-17-11)10(18)19-2/h4-5H,1-2H3,(H2,13,15,16,17)/b7-4+ |
| InChIKey | RDJYPMJXDKBPCV-QPJJXVBHSA-N |
| XLogP | 1.33 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|