C15H23N4OS+ — CID 8812268
(2S)-3-(2-methyl-2-morpholin-4-ium-4-ylpropyl)imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8812268) has the molecular formula C15H23N4OS+ and a molecular weight of 307.44 g/mol. Its IUPAC name is (2S)-3-(2-methyl-2-morpholin-4-ium-4-ylpropyl)imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | (2S)-3-(2-methyl-2-morpholin-4-ium-4-ylpropyl)imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8812268 |
| Molecular Formula | C15H23N4OS+ |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2S)-3-(2-methyl-2-morpholin-4-ium-4-ylpropyl)imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | Cc1csc([C@H](C#N)/C=N/CC(C)(C)[NH+]2CCOCC2)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-12-10-21-14(18-12)13(8-16)9-17-11-15(2,3)19-4-6-20-7-5-19/h9-10,13H,4-7,11H2,1-3H3/p+1/b17-9+/t13-/m1/s1 |
| InChIKey | VAIHXKBRHSPWIX-LFMVTYOGSA-O |
| XLogP | 0.82 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|