About (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile
(2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile (PubChem CID 8812650) has the molecular formula C14H14N4S
and a molecular weight of 270.36 g/mol. Its IUPAC name is (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile.
Molecular Properties
| Compound Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile |
| PubChem CID | 8812650 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile |
| SMILES | Cc1csc([C@@H](C#N)/C=N/[C@H](C)c2ccncc2)n1 |
| InChI | InChI=1S/C14H14N4S/c1-10-9-19-14(18-10)13(7-15)8-17-11(2)12-3-5-16-6-4-12/h3-6,8-9,11,13H,1-2H3/b17-8+/t11-,13+/m1/s1 |
| InChIKey | YZDSKDGMOMWISG-ADVQPIDESA-N |
| XLogP | 3.29 |
| TPSA | 61.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile?
The IUPAC name of (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile (CID 8812650) is (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile.
What is the SMILES notation for (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile?
The canonical SMILES for (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile is Cc1csc([C@@H](C#N)/C=N/[C@H](C)c2ccncc2)n1.
What is the InChIKey of (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile?
The InChIKey is YZDSKDGMOMWISG-ADVQPIDESA-N. The full InChI is InChI=1S/C14H14N4S/c1-10-9-19-14(18-10)13(7-15)8-17-11(2)12-3-5-16-6-4-12/h3-6,8-9,11,13H,1-2H3/b17-8+/t11-,13+/m1/s1.
What are the key properties of (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile?
(2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile has a molecular weight of 270.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-methyl-1,3-thiazol-2-yl)-3-[(1R)-1-pyridin-4-ylethyl]iminopropanenitrile is sourced from PubChem (CID 8812650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).