About 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine
4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine (PubChem CID 8812883) has the molecular formula C19H12Cl2F3NO
and a molecular weight of 398.21 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine |
| PubChem CID | 8812883 |
| Molecular Formula | C19H12Cl2F3NO |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(OCc2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H12Cl2F3NO/c20-15-7-6-12(8-16(15)21)11-26-14-9-17(13-4-2-1-3-5-13)25-18(10-14)19(22,23)24/h1-10H,11H2 |
| InChIKey | WJQVFGPAQHPRAX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine?
The IUPAC name of 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine (CID 8812883) is 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine.
What is the SMILES notation for 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine?
The canonical SMILES for 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine is FC(F)(F)c1cc(OCc2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)n1.
What is the InChIKey of 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine?
The InChIKey is WJQVFGPAQHPRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2F3NO/c20-15-7-6-12(8-16(15)21)11-26-14-9-17(13-4-2-1-3-5-13)25-18(10-14)19(22,23)24/h1-10H,11H2.
What are the key properties of 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine?
4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine has a molecular weight of 398.21 g/mol, XLogP of 6.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dichlorophenyl)methoxy]-2-phenyl-6-(trifluoromethyl)pyridine is sourced from PubChem (CID 8812883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).