C23H21NO3S — CID 8813379
N-(2-methylphenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]phenoxy]acetamide (PubChem CID 8813379) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]phenoxy]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 8813379 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(2-methylphenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]phenoxy]acetamide |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(OCC(=O)Nc3ccccc3C)cc2)s1 |
| InChI | InChI=1S/C23H21NO3S/c1-16-5-3-4-6-21(16)24-23(26)15-27-19-10-8-18(9-11-19)22(25)14-13-20-12-7-17(2)28-20/h3-14H,15H2,1-2H3,(H,24,26)/b14-13+ |
| InChIKey | PRZYJJBMNJFPLD-BUHFOSPRSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|