About N-[(2,5-dichlorophenyl)carbamothioyl]benzamide
N-[(2,5-dichlorophenyl)carbamothioyl]benzamide (PubChem CID 881405) has the molecular formula C14H10Cl2N2OS
and a molecular weight of 325.22 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)carbamothioyl]benzamide.
Molecular Properties
| Compound Name | N-[(2,5-dichlorophenyl)carbamothioyl]benzamide |
| PubChem CID | 881405 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-[(2,5-dichlorophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-10-6-7-11(16)12(8-10)17-14(20)18-13(19)9-4-2-1-3-5-9/h1-8H,(H2,17,18,19,20) |
| InChIKey | DEWHSBUUMWHCGU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,5-dichlorophenyl)carbamothioyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,5-dichlorophenyl)carbamothioyl]benzamide?
The IUPAC name of N-[(2,5-dichlorophenyl)carbamothioyl]benzamide (CID 881405) is N-[(2,5-dichlorophenyl)carbamothioyl]benzamide.
What is the SMILES notation for N-[(2,5-dichlorophenyl)carbamothioyl]benzamide?
The canonical SMILES for N-[(2,5-dichlorophenyl)carbamothioyl]benzamide is O=C(NC(=S)Nc1cc(Cl)ccc1Cl)c1ccccc1.
What is the InChIKey of N-[(2,5-dichlorophenyl)carbamothioyl]benzamide?
The InChIKey is DEWHSBUUMWHCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2OS/c15-10-6-7-11(16)12(8-10)17-14(20)18-13(19)9-4-2-1-3-5-9/h1-8H,(H2,17,18,19,20).
What are the key properties of N-[(2,5-dichlorophenyl)carbamothioyl]benzamide?
N-[(2,5-dichlorophenyl)carbamothioyl]benzamide has a molecular weight of 325.22 g/mol, XLogP of 4.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,5-dichlorophenyl)carbamothioyl]benzamide is sourced from PubChem (CID 881405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).