C24H21NO5 — CID 8814152
[(1R)-2-(3-acetylanilino)-2-oxo-1-phenylethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 8814152) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is [(1R)-2-(3-acetylanilino)-2-oxo-1-phenylethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [(1R)-2-(3-acetylanilino)-2-oxo-1-phenylethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 8814152 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(1R)-2-(3-acetylanilino)-2-oxo-1-phenylethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](OC(=O)c2cccc(C)c2O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21NO5/c1-15-8-6-13-20(21(15)27)24(29)30-22(17-9-4-3-5-10-17)23(28)25-19-12-7-11-18(14-19)16(2)26/h3-14,22,27H,1-2H3,(H,25,28)/t22-/m1/s1 |
| InChIKey | DNEWRIZHUFWAEX-JOCHJYFZSA-N |
| XLogP | 4.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |