C18H18ClN3O4 — CID 8816500
[(E)-[amino-(4-chlorophenyl)methylidene]amino] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 8816500) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is [(E)-[amino-(4-chlorophenyl)methylidene]amino] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [(E)-[amino-(4-chlorophenyl)methylidene]amino] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8816500 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(E)-[amino-(4-chlorophenyl)methylidene]amino] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | N/C(=N/OC(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O4/c19-12-7-5-11(6-8-12)16(20)21-26-15(23)9-10-22-17(24)13-3-1-2-4-14(13)18(22)25/h1-2,5-8,13-14H,3-4,9-10H2,(H2,20,21)/t13-,14+ |
| InChIKey | VTILCLMJLJSYIJ-OKILXGFUSA-N |
| XLogP | 1.84 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|