C14H19N5S — CID 881667
1-phenyl-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea (PubChem CID 881667) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 1-phenyl-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea.
| Compound Name | 1-phenyl-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea |
|---|---|
| PubChem CID | 881667 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-phenyl-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea |
| SMILES | S=C(Nc1ccccc1)NC12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C14H19N5S/c20-13(15-12-4-2-1-3-5-12)16-14-6-17-9-18(7-14)11-19(8-14)10-17/h1-5H,6-11H2,(H2,15,16,20) |
| InChIKey | FFQPQQSFGFXWSC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|