C18H25N5O3 — CID 8817826
[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 8817826) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 8817826 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | Cc1nc2ncnn2c(C)c1CC(=O)OCC(=O)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C18H25N5O3/c1-11-5-12(2)8-22(7-11)16(24)9-26-17(25)6-15-13(3)21-18-19-10-20-23(18)14(15)4/h10-12H,5-9H2,1-4H3/t11-,12+ |
| InChIKey | OLPWUEJQYSFQPG-TXEJJXNPSA-N |
| XLogP | 1.33 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |