About (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide
(3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide (PubChem CID 8818332) has the molecular formula C16H25N2O5S2+
and a molecular weight of 389.52 g/mol. Its IUPAC name is (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide |
| PubChem CID | 8818332 |
| Molecular Formula | C16H25N2O5S2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CC[NH+]([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H24N2O5S2/c1-13-3-4-15(23-2)16(11-13)25(21,22)18-8-6-17(7-9-18)14-5-10-24(19,20)12-14/h3-4,11,14H,5-10,12H2,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | PTAVUPPRGPBWSM-AWEZNQCLSA-O |
| XLogP | -0.92 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The IUPAC name of (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide (CID 8818332) is (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide.
What is the SMILES notation for (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The canonical SMILES for (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide is COc1ccc(C)cc1S(=O)(=O)N1CC[NH+]([C@H]2CCS(=O)(=O)C2)CC1.
What is the InChIKey of (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The InChIKey is PTAVUPPRGPBWSM-AWEZNQCLSA-O. The full InChI is InChI=1S/C16H24N2O5S2/c1-13-3-4-15(23-2)16(11-13)25(21,22)18-8-6-17(7-9-18)14-5-10-24(19,20)12-14/h3-4,11,14H,5-10,12H2,1-2H3/p+1/t14-/m0/s1.
What are the key properties of (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide?
(3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide has a molecular weight of 389.52 g/mol, XLogP of -0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-ium-1-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 8818332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).