C17H19N3OS4 — CID 8818849
[(1S)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] N,N-diethylcarbamodithioate (PubChem CID 8818849) has the molecular formula C17H19N3OS4 and a molecular weight of 409.63 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1S)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818849 |
| Molecular Formula | C17H19N3OS4 |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | [(1S)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C)c1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N3OS4/c1-4-20(5-2)17(22)25-10(3)14-18-15(21)13-11(9-24-16(13)19-14)12-7-6-8-23-12/h6-10H,4-5H2,1-3H3,(H,18,19,21)/t10-/m0/s1 |
| InChIKey | PLRPALWGNXDJCI-JTQLQIEISA-N |
| XLogP | 5.13 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|