About 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide
5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide (PubChem CID 8818864) has the molecular formula C7H6BrN3O4S2
and a molecular weight of 340.18 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide |
| PubChem CID | 8818864 |
| Molecular Formula | C7H6BrN3O4S2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.90 |
| IUPAC Name | 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide |
| SMILES | O=C1CN(NS(=O)(=O)c2ccc(Br)s2)C(=O)N1 |
| InChI | InChI=1S/C7H6BrN3O4S2/c8-4-1-2-6(16-4)17(14,15)10-11-3-5(12)9-7(11)13/h1-2,10H,3H2,(H,9,12,13) |
| InChIKey | CWZFBLINHWBIRQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide (CID 8818864) is 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide is O=C1CN(NS(=O)(=O)c2ccc(Br)s2)C(=O)N1.
What is the InChIKey of 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide?
The InChIKey is CWZFBLINHWBIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O4S2/c8-4-1-2-6(16-4)17(14,15)10-11-3-5(12)9-7(11)13/h1-2,10H,3H2,(H,9,12,13).
What are the key properties of 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide?
5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide has a molecular weight of 340.18 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,4-dioxoimidazolidin-1-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 8818864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).