C16H18ClNO5S — CID 8819063
2-chloro-N-[(2,4,5-trimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 8819063) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is 2-chloro-N-[(2,4,5-trimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8819063 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-chloro-N-[(2,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(OC)cc1CNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClNO5S/c1-21-13-9-15(23-3)14(22-2)8-11(13)10-18-24(19,20)16-7-5-4-6-12(16)17/h4-9,18H,10H2,1-3H3 |
| InChIKey | CJCXCPCQHLDMQT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |