C19H19N5O5 — CID 8819124
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 8819124) has the molecular formula C19H19N5O5 and a molecular weight of 397.39 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 8819124 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | Cc1nc2ncnn2c(C)c1CC(=O)O[C@H](C)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N5O5/c1-10-14(11(2)24-19(22-10)20-8-21-24)7-17(25)29-12(3)18(26)23-13-4-5-15-16(6-13)28-9-27-15/h4-6,8,12H,7,9H2,1-3H3,(H,23,26)/t12-/m1/s1 |
| InChIKey | IADAQBSKTFVOQG-GFCCVEGCSA-N |
| XLogP | 1.58 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |