C17H18N4O3S — CID 8819785
(4-oxo-4-thiophen-2-ylbutyl) 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 8819785) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 8819785 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | Cc1nc2ncnn2c(C)c1CC(=O)OCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C17H18N4O3S/c1-11-13(12(2)21-17(20-11)18-10-19-21)9-16(23)24-7-3-5-14(22)15-6-4-8-25-15/h4,6,8,10H,3,5,7,9H2,1-2H3 |
| InChIKey | CAAPFRNKJVVLIY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|