C15H25N3O3 — CID 8821701
ethyl (2R)-2-cyano-3-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylimino]propanoate (PubChem CID 8821701) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-3-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylimino]propanoate.
| Compound Name | ethyl (2R)-2-cyano-3-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylimino]propanoate |
|---|---|
| PubChem CID | 8821701 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethyl (2R)-2-cyano-3-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methylimino]propanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/C[C@@H]1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C15H25N3O3/c1-4-20-15(19)13(7-16)8-17-9-14-11-18(5-6-21-14)10-12(2)3/h8,12-14H,4-6,9-11H2,1-3H3/b17-8+/t13-,14+/m0/s1 |
| InChIKey | AKPDBRYHMOHNMN-RXZALDHMSA-N |
| XLogP | 1.12 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|