C22H26N2O5 — CID 8822089
2-methoxyethyl (6S)-3-ethyl-6-(6-methoxynaphthalen-2-yl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8822089) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-methoxyethyl (6S)-3-ethyl-6-(6-methoxynaphthalen-2-yl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl (6S)-3-ethyl-6-(6-methoxynaphthalen-2-yl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8822089 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-methoxyethyl (6S)-3-ethyl-6-(6-methoxynaphthalen-2-yl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCN1C(=O)N[C@@H](c2ccc3cc(OC)ccc3c2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C22H26N2O5/c1-5-24-14(2)19(21(25)29-11-10-27-3)20(23-22(24)26)17-7-6-16-13-18(28-4)9-8-15(16)12-17/h6-9,12-13,20H,5,10-11H2,1-4H3,(H,23,26)/t20-/m0/s1 |
| InChIKey | XVKKDITXBSCCDD-FQEVSTJZSA-N |
| XLogP | 3.40 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|