About [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate
[2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate (PubChem CID 882227) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate |
| PubChem CID | 882227 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C15H14O4/c1-10-5-6-12(8-11(10)2)13(16)9-19-15(17)14-4-3-7-18-14/h3-8H,9H2,1-2H3 |
| InChIKey | UDTDGBOUZKNRIU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate?
The IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate (CID 882227) is [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate?
The canonical SMILES for [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate is Cc1ccc(C(=O)COC(=O)c2ccco2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate?
The InChIKey is UDTDGBOUZKNRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c1-10-5-6-12(8-11(10)2)13(16)9-19-15(17)14-4-3-7-18-14/h3-8H,9H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate?
[2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate has a molecular weight of 258.27 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-2-oxoethyl] furan-2-carboxylate is sourced from PubChem (CID 882227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).