About 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate
2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate (PubChem CID 8822651) has the molecular formula C15H19BrN2O4S
and a molecular weight of 403.30 g/mol. Its IUPAC name is 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate |
| PubChem CID | 8822651 |
| Molecular Formula | C15H19BrN2O4S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=O)N(C)[C@@H]1c1cc(Br)cs1 |
| InChI | InChI=1S/C15H19BrN2O4S/c1-9-12(14(19)22-6-5-21-4)13(11-7-10(16)8-23-11)18(3)15(20)17(9)2/h7-8,13H,5-6H2,1-4H3/t13-/m1/s1 |
| InChIKey | DLZREPCODXOFJD-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate?
The IUPAC name of 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate (CID 8822651) is 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate.
What is the SMILES notation for 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate?
The canonical SMILES for 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate is COCCOC(=O)C1=C(C)N(C)C(=O)N(C)[C@@H]1c1cc(Br)cs1.
What is the InChIKey of 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate?
The InChIKey is DLZREPCODXOFJD-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H19BrN2O4S/c1-9-12(14(19)22-6-5-21-4)13(11-7-10(16)8-23-11)18(3)15(20)17(9)2/h7-8,13H,5-6H2,1-4H3/t13-/m1/s1.
What are the key properties of 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate?
2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate has a molecular weight of 403.30 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl (4S)-4-(4-bromothiophen-2-yl)-1,3,6-trimethyl-2-oxo-4H-pyrimidine-5-carboxylate is sourced from PubChem (CID 8822651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).