About N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide
N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide (PubChem CID 8822942) has the molecular formula C9H16N4O3S
and a molecular weight of 260.32 g/mol. Its IUPAC name is N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide.
Molecular Properties
| Compound Name | N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide |
| PubChem CID | 8822942 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide |
| SMILES | CCC(=O)NNS(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C9H16N4O3S/c1-5-8(14)10-12-17(15,16)9-6(2)11-13(4)7(9)3/h12H,5H2,1-4H3,(H,10,14) |
| InChIKey | QARPHVCUOCLTOU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide?
The IUPAC name of N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide (CID 8822942) is N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide.
What is the SMILES notation for N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide?
The canonical SMILES for N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide is CCC(=O)NNS(=O)(=O)c1c(C)nn(C)c1C.
What is the InChIKey of N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide?
The InChIKey is QARPHVCUOCLTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3S/c1-5-8(14)10-12-17(15,16)9-6(2)11-13(4)7(9)3/h12H,5H2,1-4H3,(H,10,14).
What are the key properties of N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide?
N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide has a molecular weight of 260.32 g/mol, XLogP of -0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylpropanehydrazide is sourced from PubChem (CID 8822942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).