About 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide
2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide (PubChem CID 8823088) has the molecular formula C12H16N4O4S
and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide |
| PubChem CID | 8823088 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NNC(=O)c1ccoc1C |
| InChI | InChI=1S/C12H16N4O4S/c1-7-11(8(2)16(4)14-7)21(18,19)15-13-12(17)10-5-6-20-9(10)3/h5-6,15H,1-4H3,(H,13,17) |
| InChIKey | YFEYHXKKSDROLK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide?
The IUPAC name of 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide (CID 8823088) is 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide.
What is the SMILES notation for 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide?
The canonical SMILES for 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide is Cc1nn(C)c(C)c1S(=O)(=O)NNC(=O)c1ccoc1C.
What is the InChIKey of 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide?
The InChIKey is YFEYHXKKSDROLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O4S/c1-7-11(8(2)16(4)14-7)21(18,19)15-13-12(17)10-5-6-20-9(10)3/h5-6,15H,1-4H3,(H,13,17).
What are the key properties of 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide?
2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide has a molecular weight of 312.35 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylfuran-3-carbohydrazide is sourced from PubChem (CID 8823088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).