C18H27N5O2S — CID 8823118
N-[4-(4-ethylpiperazin-1-yl)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 8823118) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 8823118 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | CCN1CCN(c2ccc(NS(=O)(=O)c3c(C)nn(C)c3C)cc2)CC1 |
| InChI | InChI=1S/C18H27N5O2S/c1-5-22-10-12-23(13-11-22)17-8-6-16(7-9-17)20-26(24,25)18-14(2)19-21(4)15(18)3/h6-9,20H,5,10-13H2,1-4H3 |
| InChIKey | MLJQXLSOYOKWID-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|