C12H8F3N3O2S — CID 882368
N-(1,3-thiazol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 882368) has the molecular formula C12H8F3N3O2S and a molecular weight of 315.28 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 882368 |
| Molecular Formula | C12H8F3N3O2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | O=C(Nc1nccs1)c1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H8F3N3O2S/c13-12(14,15)10(20)17-8-4-2-1-3-7(8)9(19)18-11-16-5-6-21-11/h1-6H,(H,17,20)(H,16,18,19) |
| InChIKey | KUCONTQVMKQBSF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |