C11H11FN4S — CID 882466
3-ethyl-4-[(4-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 882466) has the molecular formula C11H11FN4S and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-ethyl-4-[(4-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-ethyl-4-[(4-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 882466 |
| Molecular Formula | C11H11FN4S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-ethyl-4-[(4-fluorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1N=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FN4S/c1-2-10-14-15-11(17)16(10)13-7-8-3-5-9(12)6-4-8/h3-7H,2H2,1H3,(H,15,17) |
| InChIKey | OGNRSFGGTGYKSX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|