C19H24ClN5O3 — CID 8825492
[(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate (PubChem CID 8825492) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate.
| Compound Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8825492 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate |
| SMILES | C[C@H](OC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H24ClN5O3/c1-13(19(27)21-16-6-4-2-3-5-7-16)28-17(26)12-25-23-18(22-24-25)14-8-10-15(20)11-9-14/h8-11,13,16H,2-7,12H2,1H3,(H,21,27)/t13-/m0/s1 |
| InChIKey | UNUBAXLHHGJMGI-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |