C17H21N2O3+ — CID 8828237
methyl 5-[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 8828237) has the molecular formula C17H21N2O3+ and a molecular weight of 301.37 g/mol. Its IUPAC name is methyl 5-[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8828237 |
| Molecular Formula | C17H21N2O3+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 5-[2-(2,3-dimethylpyridin-1-ium-1-yl)acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)C[n+]2cccc(C)c2C)c1C |
| InChI | InChI=1S/C17H20N2O3/c1-10-7-6-8-19(13(10)4)9-14(20)16-11(2)15(12(3)18-16)17(21)22-5/h6-8H,9H2,1-5H3/p+1 |
| InChIKey | QCHKAZYKSQPAIE-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|