C19H16ClNO4 — CID 8828924
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-methoxybenzoyl)prop-2-enenitrile (PubChem CID 8828924) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-methoxybenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-methoxybenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8828924 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-methoxybenzoyl)prop-2-enenitrile |
| SMILES | COc1ccc(C(=O)/C(C#N)=C/c2cc(Cl)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H16ClNO4/c1-23-15-6-4-13(5-7-15)18(22)14(11-21)8-12-9-16(20)19(25-3)17(10-12)24-2/h4-10H,1-3H3/b14-8+ |
| InChIKey | DMXRNUAOVNSIIH-RIYZIHGNSA-N |
| XLogP | 4.16 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|