C25H39N3O3 — CID 8829362
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 8829362) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 8829362 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(C)c(CN2CCN(CC(=O)N3CC[C@H]4CCCC[C@H]4C3)CC2)cc1OC |
| InChI | InChI=1S/C25H39N3O3/c1-19-14-23(30-2)24(31-3)15-22(19)16-26-10-12-27(13-11-26)18-25(29)28-9-8-20-6-4-5-7-21(20)17-28/h14-15,20-21H,4-13,16-18H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | ZTAGQSQWUIQNNI-RTWAWAEBSA-N |
| XLogP | 3.17 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |