C11H12F3N4O2+ — CID 8829769
3-[5,7-dimethyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl]propanoic acid (PubChem CID 8829769) has the molecular formula C11H12F3N4O2+ and a molecular weight of 289.24 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl]propanoic acid.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl]propanoic acid |
|---|---|
| PubChem CID | 8829769 |
| Molecular Formula | C11H12F3N4O2+ |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl]propanoic acid |
| SMILES | Cc1nc2nc(C(F)(F)F)[nH][n+]2c(C)c1CCC(=O)O |
| InChI | InChI=1S/C11H11F3N4O2/c1-5-7(3-4-8(19)20)6(2)18-10(15-5)16-9(17-18)11(12,13)14/h3-4H2,1-2H3,(H,19,20)/p+1 |
| InChIKey | RXGDIZGVBPYXKR-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|