About (2-bromophenyl)methyl carbamimidothioate
(2-bromophenyl)methyl carbamimidothioate (PubChem CID 8830113) has the molecular formula C8H9BrN2S
and a molecular weight of 245.15 g/mol. Its IUPAC name is (2-bromophenyl)methyl carbamimidothioate.
Molecular Properties
| Compound Name | (2-bromophenyl)methyl carbamimidothioate |
| PubChem CID | 8830113 |
| Molecular Formula | C8H9BrN2S |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | (2-bromophenyl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccccc1Br |
| InChI | InChI=1S/C8H9BrN2S/c9-7-4-2-1-3-6(7)5-12-8(10)11/h1-4H,5H2,(H3,10,11) |
| InChIKey | QKGCNDUPXQUAPW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)methyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)methyl carbamimidothioate?
The IUPAC name of (2-bromophenyl)methyl carbamimidothioate (CID 8830113) is (2-bromophenyl)methyl carbamimidothioate.
What is the SMILES notation for (2-bromophenyl)methyl carbamimidothioate?
The canonical SMILES for (2-bromophenyl)methyl carbamimidothioate is [H]/N=C(\N)SCc1ccccc1Br.
What is the InChIKey of (2-bromophenyl)methyl carbamimidothioate?
The InChIKey is QKGCNDUPXQUAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2S/c9-7-4-2-1-3-6(7)5-12-8(10)11/h1-4H,5H2,(H3,10,11).
What are the key properties of (2-bromophenyl)methyl carbamimidothioate?
(2-bromophenyl)methyl carbamimidothioate has a molecular weight of 245.15 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)methyl carbamimidothioate is sourced from PubChem (CID 8830113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).