About 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate
4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate (PubChem CID 8831358) has the molecular formula C17H20NO4-
and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate.
Molecular Properties
| Compound Name | 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate |
| PubChem CID | 8831358 |
| Molecular Formula | C17H20NO4- |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C(=Cc2ccc([O-])c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C17H21NO4/c1-10(2)13-6-4-11(3)14(17(13)20)8-12-5-7-16(19)15(9-12)18(21)22/h5,7-11,13,19H,4,6H2,1-3H3/p-1/t11-,13-/m1/s1 |
| InChIKey | BXXVTEGKGKRIQY-DGCLKSJQSA-M |
| XLogP | 3.32 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate?
The IUPAC name of 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate (CID 8831358) is 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate.
What is the SMILES notation for 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate?
The canonical SMILES for 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate is CC(C)[C@H]1CC[C@@H](C)C(=Cc2ccc([O-])c([N+](=O)[O-])c2)C1=O.
What is the InChIKey of 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate?
The InChIKey is BXXVTEGKGKRIQY-DGCLKSJQSA-M. The full InChI is InChI=1S/C17H21NO4/c1-10(2)13-6-4-11(3)14(17(13)20)8-12-5-7-16(19)15(9-12)18(21)22/h5,7-11,13,19H,4,6H2,1-3H3/p-1/t11-,13-/m1/s1.
What are the key properties of 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate?
4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate has a molecular weight of 302.35 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]-2-nitrophenolate is sourced from PubChem (CID 8831358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).