2,3-diphenylquinoline-4-carboxylic acid

C22H15NO2 — CID 883168

IUPAC2,3-diphenylquinoline-4-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)c(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C22H15NO2/c24-22(25)20-17-13-7-8-14-18(17)23-21(16-11-5-2-6-12-16)19(20)15-9-3-1-4-10-15/h1-14H,(H,24,25)
InChIKeyZBKJWKHDYQZPFG-UHFFFAOYSA-N
MW325.37 g/mol
LogP5.27
Rot. Bonds3

About 2,3-diphenylquinoline-4-carboxylic acid

2,3-diphenylquinoline-4-carboxylic acid (PubChem CID 883168) has the molecular formula C22H15NO2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2,3-diphenylquinoline-4-carboxylic acid.

Molecular Properties

Compound Name2,3-diphenylquinoline-4-carboxylic acid
PubChem CID883168
Molecular FormulaC22H15NO2
Molecular Weight325.37 g/mol
Exact Mass325.11
IUPAC Name2,3-diphenylquinoline-4-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)c(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C22H15NO2/c24-22(25)20-17-13-7-8-14-18(17)23-21(16-11-5-2-6-12-16)19(20)15-9-3-1-4-10-15/h1-14H,(H,24,25)
InChIKeyZBKJWKHDYQZPFG-UHFFFAOYSA-N
XLogP5.27
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500325.37
LogP ≤ 55.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,3-diphenylquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-diphenylquinoline-4-carboxylic acid?
The IUPAC name of 2,3-diphenylquinoline-4-carboxylic acid (CID 883168) is 2,3-diphenylquinoline-4-carboxylic acid.
What is the SMILES notation for 2,3-diphenylquinoline-4-carboxylic acid?
The canonical SMILES for 2,3-diphenylquinoline-4-carboxylic acid is O=C(O)c1c(-c2ccccc2)c(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 2,3-diphenylquinoline-4-carboxylic acid?
The InChIKey is ZBKJWKHDYQZPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO2/c24-22(25)20-17-13-7-8-14-18(17)23-21(16-11-5-2-6-12-16)19(20)15-9-3-1-4-10-15/h1-14H,(H,24,25).
What are the key properties of 2,3-diphenylquinoline-4-carboxylic acid?
2,3-diphenylquinoline-4-carboxylic acid has a molecular weight of 325.37 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylquinoline-4-carboxylic acid is sourced from PubChem (CID 883168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).