C24H32N2O3 — CID 8832055
N-(2,6-diethylphenyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 8832055) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8832055 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN1CCC[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C24H32N2O3/c1-5-17-9-7-10-18(6-2)24(17)25-23(27)16-26-14-8-11-21(26)20-15-19(28-3)12-13-22(20)29-4/h7,9-10,12-13,15,21H,5-6,8,11,14,16H2,1-4H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | PTSHRBGGSXBWGA-NRFANRHFSA-N |
| XLogP | 4.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |