About N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide (PubChem CID 8832224) has the molecular formula C19H17N3OS
and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide |
| PubChem CID | 8832224 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide |
| SMILES | O=C(Cn1c(-c2ccccc2)cc2ccccc21)NC1=NCCS1 |
| InChI | InChI=1S/C19H17N3OS/c23-18(21-19-20-10-11-24-19)13-22-16-9-5-4-8-15(16)12-17(22)14-6-2-1-3-7-14/h1-9,12H,10-11,13H2,(H,20,21,23) |
| InChIKey | RVZFPBJYWZGVBI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide?
The IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide (CID 8832224) is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide.
What is the SMILES notation for N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide?
The canonical SMILES for N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide is O=C(Cn1c(-c2ccccc2)cc2ccccc21)NC1=NCCS1.
What is the InChIKey of N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide?
The InChIKey is RVZFPBJYWZGVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3OS/c23-18(21-19-20-10-11-24-19)13-22-16-9-5-4-8-15(16)12-17(22)14-6-2-1-3-7-14/h1-9,12H,10-11,13H2,(H,20,21,23).
What are the key properties of N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide?
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide has a molecular weight of 335.43 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-phenylindol-1-yl)acetamide is sourced from PubChem (CID 8832224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).