About 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole
1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole (PubChem CID 883333) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole |
| PubChem CID | 883333 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole |
| SMILES | COc1ccc(Cn2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C14H17NO/c1-11-4-5-12(2)15(11)10-13-6-8-14(16-3)9-7-13/h4-9H,10H2,1-3H3 |
| InChIKey | VDIDWYVYQADTCC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole?
The IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole (CID 883333) is 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole.
What is the SMILES notation for 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole?
The canonical SMILES for 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole is COc1ccc(Cn2c(C)ccc2C)cc1.
What is the InChIKey of 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole?
The InChIKey is VDIDWYVYQADTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-11-4-5-12(2)15(11)10-13-6-8-14(16-3)9-7-13/h4-9H,10H2,1-3H3.
What are the key properties of 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole?
1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole has a molecular weight of 215.30 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxyphenyl)methyl]-2,5-dimethylpyrrole is sourced from PubChem (CID 883333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).