About 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde
1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 88338883) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 1,4-dibutoxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 88338883 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1,4-dibutoxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCCCOC1=CCC(C=C1)(C=O)OCCCC |
| InChI | InChI=1S/C15H24O3/c1-3-5-11-17-14-7-9-15(13-16,10-8-14)18-12-6-4-2/h7-9,13H,3-6,10-12H2,1-2H3 |
| InChIKey | JMFPYQHKXCXKGB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | 307 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde (CID 88338883) is 1,4-dibutoxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde is CCCCOC1=CCC(C=C1)(C=O)OCCCC.
What is the InChIKey of 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is JMFPYQHKXCXKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-5-11-17-14-7-9-15(13-16,10-8-14)18-12-6-4-2/h7-9,13H,3-6,10-12H2,1-2H3.
What are the key properties of 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde?
1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 252.35 g/mol, XLogP of 3.30, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-Dibutoxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 88338883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).