About 3,7-dimethyloct-6-enyl butanoate
3,7-dimethyloct-6-enyl butanoate (PubChem CID 8835) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl butanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl butanoate |
| PubChem CID | 8835 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3,7-dimethyloct-6-enyl butanoate |
| SMILES | CCCC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C14H26O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,13H,5-7,9-11H2,1-4H3 |
| InChIKey | XQPZQXTWYZAXAK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl butanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl butanoate (CID 8835) is 3,7-dimethyloct-6-enyl butanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl butanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl butanoate is CCCC(=O)OCCC(C)CCC=C(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl butanoate?
The InChIKey is XQPZQXTWYZAXAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,13H,5-7,9-11H2,1-4H3.
What are the key properties of 3,7-dimethyloct-6-enyl butanoate?
3,7-dimethyloct-6-enyl butanoate has a molecular weight of 226.36 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl butanoate is sourced from PubChem (CID 8835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).