C14H17N5O3 — CID 8835372
4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 8835372) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 8835372 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C14H17N5O3/c20-11(17-14-15-8-16-18-14)6-3-7-19-12(21)9-4-1-2-5-10(9)13(19)22/h1-2,8-10H,3-7H2,(H2,15,16,17,18,20)/t9-,10+ |
| InChIKey | PGWWIVRFELLFMI-AOOOYVTPSA-N |
| XLogP | 0.47 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|