About 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide
4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 883547) has the molecular formula C14H15N3O2S
and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 883547 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-2-3-12(18)16-11-6-4-10(5-7-11)13(19)17-14-15-8-9-20-14/h4-9H,2-3H2,1H3,(H,16,18)(H,15,17,19) |
| InChIKey | HIPNUROOFUMNSU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide (CID 883547) is 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide is CCCC(=O)Nc1ccc(C(=O)Nc2nccs2)cc1.
What is the InChIKey of 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is HIPNUROOFUMNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2S/c1-2-3-12(18)16-11-6-4-10(5-7-11)13(19)17-14-15-8-9-20-14/h4-9H,2-3H2,1H3,(H,16,18)(H,15,17,19).
What are the key properties of 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide?
4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 289.36 g/mol, XLogP of 3.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butanoylamino)-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 883547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).